C34H24N2Pt — CID 58939535
bis(2-(4-phenylbenzene-6-id-1-yl)pyridine);platinum(2+) (PubChem CID 58939535) has the molecular formula C34H24N2Pt and a molecular weight of 655.66 g/mol. Its IUPAC name is bis(2-(4-phenylbenzene-6-id-1-yl)pyridine);platinum(2+).
| Compound Name | bis(2-(4-phenylbenzene-6-id-1-yl)pyridine);platinum(2+) |
|---|---|
| PubChem CID | 58939535 |
| Molecular Formula | C34H24N2Pt |
| Molecular Weight | 655.66 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | bis(2-(4-phenylbenzene-6-id-1-yl)pyridine);platinum(2+) |
| SMILES | [Pt+2].[c-]1cc(-c2ccccc2)ccc1-c1ccccn1.[c-]1cc(-c2ccccc2)ccc1-c1ccccn1 |
| InChI | InChI=1S/2C17H12N.Pt/c2*1-2-6-14(7-3-1)15-9-11-16(12-10-15)17-8-4-5-13-18-17;/h2*1-11,13H;/q2*-1;+2 |
| InChIKey | YDKJCNMNMINWLU-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.66 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|