C43H34IrN3 — CID 59005128
2-[4-(4-but-2-en-2-ylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+);bis(2-phenylpyridine) (PubChem CID 59005128) has the molecular formula C43H34IrN3 and a molecular weight of 784.98 g/mol. Its IUPAC name is 2-[4-(4-but-2-en-2-ylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+);bis(2-phenylpyridine).
| Compound Name | 2-[4-(4-but-2-en-2-ylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+);bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59005128 |
| Molecular Formula | C43H34IrN3 |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 785.24 |
| IUPAC Name | 2-[4-(4-but-2-en-2-ylphenyl)benzene-6-id-1-yl]pyridine;iridium(3+);bis(2-phenylpyridine) |
| SMILES | CC=C(C)c1ccc(-c2c[c-]c(-c3ccccn3)cc2)cc1.[Ir+3].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C21H18N.2C11H8N.Ir/c1-3-16(2)17-7-9-18(10-8-17)19-11-13-20(14-12-19)21-6-4-5-15-22-21;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-13,15H,1-2H3;2*1-6,8-9H;/q3*-1;+3 |
| InChIKey | ZASFOACIWLEUFR-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|