C24H16NOPt- — CID 59538579
phenyl-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]methanone;platinum (PubChem CID 59538579) has the molecular formula C24H16NOPt- and a molecular weight of 529.48 g/mol. Its IUPAC name is phenyl-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]methanone;platinum.
| Compound Name | phenyl-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]methanone;platinum |
|---|---|
| PubChem CID | 59538579 |
| Molecular Formula | C24H16NOPt- |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | phenyl-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]methanone;platinum |
| SMILES | O=C(c1ccccc1)c1ccc(-c2c[c-]c(-c3ccccn3)cc2)cc1.[Pt] |
| InChI | InChI=1S/C24H16NO.Pt/c26-24(21-6-2-1-3-7-21)22-15-11-19(12-16-22)18-9-13-20(14-10-18)23-8-4-5-17-25-23;/h1-13,15-17H;/q-1; |
| InChIKey | SNJBTNVNOHBAPX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|