C16H15F5IrNO2S- — CID 152840159
4-hydroxypent-3-en-2-one;iridium;pentafluoro-(4-pyridin-2-ylbenzene-5-id-1-yl)-λ6-sulfane (PubChem CID 152840159) has the molecular formula C16H15F5IrNO2S- and a molecular weight of 572.58 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;iridium;pentafluoro-(4-pyridin-2-ylbenzene-5-id-1-yl)-λ6-sulfane.
| Compound Name | 4-hydroxypent-3-en-2-one;iridium;pentafluoro-(4-pyridin-2-ylbenzene-5-id-1-yl)-λ6-sulfane |
|---|---|
| PubChem CID | 152840159 |
| Molecular Formula | C16H15F5IrNO2S- |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;iridium;pentafluoro-(4-pyridin-2-ylbenzene-5-id-1-yl)-λ6-sulfane |
| SMILES | CC(=O)C=C(C)O.FS(F)(F)(F)(F)c1c[c-]c(-c2ccccn2)cc1.[Ir] |
| InChI | InChI=1S/C11H7F5NS.C5H8O2.Ir/c12-18(13,14,15,16)10-6-4-9(5-7-10)11-3-1-2-8-17-11;1-4(6)3-5(2)7;/h1-4,6-8H;3,6H,1-2H3;/q-1;; |
| InChIKey | WODYJQCDWSRRTL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|