C16H14ClNO2Pt — CID 57412518
2-(4-chlorobenzene-6-id-1-yl)pyridine;(Z)-4-oxopent-2-en-2-olate;platinum(2+) (PubChem CID 57412518) has the molecular formula C16H14ClNO2Pt and a molecular weight of 482.82 g/mol. Its IUPAC name is 2-(4-chlorobenzene-6-id-1-yl)pyridine;(Z)-4-oxopent-2-en-2-olate;platinum(2+).
| Compound Name | 2-(4-chlorobenzene-6-id-1-yl)pyridine;(Z)-4-oxopent-2-en-2-olate;platinum(2+) |
|---|---|
| PubChem CID | 57412518 |
| Molecular Formula | C16H14ClNO2Pt |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 2-(4-chlorobenzene-6-id-1-yl)pyridine;(Z)-4-oxopent-2-en-2-olate;platinum(2+) |
| SMILES | CC(=O)/C=C(/C)[O-].Clc1c[c-]c(-c2ccccn2)cc1.[Pt+2] |
| InChI | InChI=1S/C11H7ClN.C5H8O2.Pt/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11;1-4(6)3-5(2)7;/h1-4,6-8H;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | LWRMYVXVRCYGTN-LWFKIUJUSA-M |
| XLogP | 3.04 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|