C17H15IrN2O2- — CID 58162321
(Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-isocyanobenzene-6-id-1-yl)pyridine (PubChem CID 58162321) has the molecular formula C17H15IrN2O2- and a molecular weight of 471.54 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-isocyanobenzene-6-id-1-yl)pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-isocyanobenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 58162321 |
| Molecular Formula | C17H15IrN2O2- |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(3-isocyanobenzene-6-id-1-yl)pyridine |
| SMILES | CC(=O)/C=C(/C)O.[C-]#[N+]c1cc[c-]c(-c2ccccn2)c1.[Ir] |
| InChI | InChI=1S/C12H7N2.C5H8O2.Ir/c1-13-11-6-4-5-10(9-11)12-7-2-3-8-14-12;1-4(6)3-5(2)7;/h2-4,6-9H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | BNIYWNIYJXBEPJ-LWFKIUJUSA-N |
| XLogP | 4.13 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|