C14H14NO2RhS- — CID 58963787
(Z)-4-hydroxypent-3-en-2-one;rhodium;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 58963787) has the molecular formula C14H14NO2RhS- and a molecular weight of 363.24 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;rhodium;2-(3H-thiophen-3-id-2-yl)pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;rhodium;2-(3H-thiophen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 58963787 |
| Molecular Formula | C14H14NO2RhS- |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;rhodium;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | CC(=O)/C=C(/C)O.[Rh].[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C9H6NS.C5H8O2.Rh/c1-2-6-10-8(4-1)9-5-3-7-11-9;1-4(6)3-5(2)7;/h1-4,6-7H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SGOKUVILORFFPH-LWFKIUJUSA-N |
| XLogP | 3.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|