About carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine
carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 23526386) has the molecular formula C10H9IrNS-2
and a molecular weight of 367.47 g/mol. Its IUPAC name is carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine.
Molecular Properties
| Compound Name | carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
| PubChem CID | 23526386 |
| Molecular Formula | C10H9IrNS-2 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | [CH3-].[Ir].[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C9H6NS.CH3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;;/h1-4,6-7H;1H3;/q2*-1; |
| InChIKey | SBYGJCINIWJPBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The IUPAC name of carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine (CID 23526386) is carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine.
What is the SMILES notation for carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The canonical SMILES for carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine is [CH3-].[Ir].[c-]1ccsc1-c1ccccn1.
What is the InChIKey of carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
The InChIKey is SBYGJCINIWJPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6NS.CH3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;;/h1-4,6-7H;1H3;/q2*-1;.
What are the key properties of carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine?
carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine has a molecular weight of 367.47 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;iridium;2-(3H-thiophen-3-id-2-yl)pyridine is sourced from PubChem (CID 23526386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).