C58H46IrN4O2-4 — CID 154588954
(Z)-1-[2-[3,5-bis[2-[4-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-5-id-1-yl]phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium (PubChem CID 154588954) has the molecular formula C58H46IrN4O2-4 and a molecular weight of 1023.25 g/mol. Its IUPAC name is (Z)-1-[2-[3,5-bis[2-[4-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-5-id-1-yl]phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium.
| Compound Name | (Z)-1-[2-[3,5-bis[2-[4-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-5-id-1-yl]phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154588954 |
| Molecular Formula | C58H46IrN4O2-4 |
| Molecular Weight | 1023.25 g/mol |
| Exact Mass | 1023.33 |
| IUPAC Name | (Z)-1-[2-[3,5-bis[2-[4-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-5-id-1-yl]phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
| SMILES | C/C(O)=C/C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2c[c-]c(N3[CH-]N(C)c4ccccc43)cc2)cc(-c2ccccc2-c2c[c-]c(N3[CH-]N(C)c4ccccc43)cc2)c1.[Ir] |
| InChI | InChI=1S/C58H46N4O2.Ir/c1-40(63)34-49(64)33-28-41-14-4-5-15-50(41)44-35-45(53-18-8-6-16-51(53)42-24-29-47(30-25-42)61-38-59(2)55-20-10-12-22-57(55)61)37-46(36-44)54-19-9-7-17-52(54)43-26-31-48(32-27-43)62-39-60(3)56-21-11-13-23-58(56)62;/h4-27,29,31,34-39,63H,28,33H2,1-3H3;/q-4;/b40-34-; |
| InChIKey | YFPNOIQCPXLGLO-MBMZUTQCSA-N |
| XLogP | 14.00 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.25 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|