C14H12LrN2-2 — CID 170209546
lawrencium;1-methyl-3-phenyl-2H-benzimidazol-2-ide (PubChem CID 170209546) has the molecular formula C14H12LrN2-2 and a molecular weight of 470.26 g/mol. Its IUPAC name is lawrencium;1-methyl-3-phenyl-2H-benzimidazol-2-ide.
| Compound Name | lawrencium;1-methyl-3-phenyl-2H-benzimidazol-2-ide |
|---|---|
| PubChem CID | 170209546 |
| Molecular Formula | C14H12LrN2-2 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | lawrencium;1-methyl-3-phenyl-2H-benzimidazol-2-ide |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Lr] |
| InChI | InChI=1S/C14H12N2.Lr/c1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h2-7,9-11H,1H3;/q-2; |
| InChIKey | NOXBBSKQFAMZTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|