C37H32IrN5 — CID 140736391
4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;iridium(3+);1-methyl-3-phenyl-2H-benzimidazol-2-ide (PubChem CID 140736391) has the molecular formula C37H32IrN5 and a molecular weight of 738.92 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;iridium(3+);1-methyl-3-phenyl-2H-benzimidazol-2-ide.
| Compound Name | 4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;iridium(3+);1-methyl-3-phenyl-2H-benzimidazol-2-ide |
|---|---|
| PubChem CID | 140736391 |
| Molecular Formula | C37H32IrN5 |
| Molecular Weight | 738.92 g/mol |
| Exact Mass | 739.23 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-3-(2-methylphenyl)-5-phenyl-1,2,4-triazole;iridium(3+);1-methyl-3-phenyl-2H-benzimidazol-2-ide |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.Cc1ccccc1-c1nnc(-c2[c-]cccc2)n1-c1c(C)cccc1C.[Ir+3] |
| InChI | InChI=1S/C23H20N3.C14H12N2.Ir/c1-16-10-7-8-15-20(16)23-25-24-22(19-13-5-4-6-14-19)26(23)21-17(2)11-9-12-18(21)3;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h4-13,15H,1-3H3;2-7,9-11H,1H3;/q-1;-2;+3 |
| InChIKey | VQLQVIAZUGXFIS-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.92 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|