C27H22IrN2-2 — CID 140794449
1,5-bis(2-methylphenyl)-3-phenyl-2H-benzimidazol-2-ide;iridium (PubChem CID 140794449) has the molecular formula C27H22IrN2-2 and a molecular weight of 566.70 g/mol. Its IUPAC name is 1,5-bis(2-methylphenyl)-3-phenyl-2H-benzimidazol-2-ide;iridium.
| Compound Name | 1,5-bis(2-methylphenyl)-3-phenyl-2H-benzimidazol-2-ide;iridium |
|---|---|
| PubChem CID | 140794449 |
| Molecular Formula | C27H22IrN2-2 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 1,5-bis(2-methylphenyl)-3-phenyl-2H-benzimidazol-2-ide;iridium |
| SMILES | Cc1ccccc1-c1ccc2c(c1)N(c1[c-]cccc1)[CH-]N2c1ccccc1C.[Ir] |
| InChI | InChI=1S/C27H22N2.Ir/c1-20-10-6-8-14-24(20)22-16-17-26-27(18-22)28(23-12-4-3-5-13-23)19-29(26)25-15-9-7-11-21(25)2;/h3-12,14-19H,1-2H3;/q-2; |
| InChIKey | WVGYWTICOVNHLZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|