C34H60N2OsP2 — CID 147264576
osmium;1,5,6-trimethyl-3-phenyl-2H-benzimidazol-2-ide;bis(tri(propan-2-yl)phosphanium) (PubChem CID 147264576) has the molecular formula C34H60N2OsP2 and a molecular weight of 749.05 g/mol. Its IUPAC name is osmium;1,5,6-trimethyl-3-phenyl-2H-benzimidazol-2-ide;bis(tri(propan-2-yl)phosphanium).
| Compound Name | osmium;1,5,6-trimethyl-3-phenyl-2H-benzimidazol-2-ide;bis(tri(propan-2-yl)phosphanium) |
|---|---|
| PubChem CID | 147264576 |
| Molecular Formula | C34H60N2OsP2 |
| Molecular Weight | 749.05 g/mol |
| Exact Mass | 750.38 |
| IUPAC Name | osmium;1,5,6-trimethyl-3-phenyl-2H-benzimidazol-2-ide;bis(tri(propan-2-yl)phosphanium) |
| SMILES | CC(C)[PH+](C(C)C)C(C)C.CC(C)[PH+](C(C)C)C(C)C.Cc1cc2c(cc1C)N(c1[c-]cccc1)[CH-]N2C.[Os] |
| InChI | InChI=1S/C16H16N2.2C9H21P.Os/c1-12-9-15-16(10-13(12)2)18(11-17(15)3)14-7-5-4-6-8-14;2*1-7(2)10(8(3)4)9(5)6;/h4-7,9-11H,1-3H3;2*7-9H,1-6H3;/q-2;;;/p+2 |
| InChIKey | DXQHZPZIKYPLPR-UHFFFAOYSA-P |
| XLogP | 10.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.05 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|