C31H27IrN5O-4 — CID 140637817
CID 140637817 (PubChem CID 140637817) has the molecular formula C31H27IrN5O-4 and a molecular weight of 677.81 g/mol.
| Compound Name | CID 140637817 |
|---|---|
| PubChem CID | 140637817 |
| Molecular Formula | C31H27IrN5O-4 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | — |
| SMILES | CC(C)N1C=NN(c2[c-]ccc3oc4ccccc4c23)[CH-]1.CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Ir] |
| InChI | InChI=1S/C17H15N3O.C14H12N2.Ir/c1-12(2)19-10-18-20(11-19)14-7-5-9-16-17(14)13-6-3-4-8-15(13)21-16;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h3-6,8-12H,1-2H3;2-7,9-11H,1H3;/q2*-2; |
| InChIKey | GGPWAHBSZLLMTL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|