C15H9IrN2O- — CID 59858920
1-(2H-dibenzofuran-2-id-1-yl)pyrazole;iridium (PubChem CID 59858920) has the molecular formula C15H9IrN2O- and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-(2H-dibenzofuran-2-id-1-yl)pyrazole;iridium.
| Compound Name | 1-(2H-dibenzofuran-2-id-1-yl)pyrazole;iridium |
|---|---|
| PubChem CID | 59858920 |
| Molecular Formula | C15H9IrN2O- |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-(2H-dibenzofuran-2-id-1-yl)pyrazole;iridium |
| SMILES | [Ir].[c-]1ccc2oc3ccccc3c2c1-n1cccn1 |
| InChI | InChI=1S/C15H9N2O.Ir/c1-2-7-13-11(5-1)15-12(17-10-4-9-16-17)6-3-8-14(15)18-13;/h1-5,7-10H;/q-1; |
| InChIKey | JRYHQJUMGZUXBY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|