C20H11F6IrN2O3- — CID 59858884
1-(3H-dibenzofuran-3-id-4-yl)pyrazole;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59858884) has the molecular formula C20H11F6IrN2O3- and a molecular weight of 633.52 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-4-yl)pyrazole;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 1-(3H-dibenzofuran-3-id-4-yl)pyrazole;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59858884 |
| Molecular Formula | C20H11F6IrN2O3- |
| Molecular Weight | 633.52 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-4-yl)pyrazole;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir].[c-]1ccc2c(oc3ccccc32)c1-n1cccn1 |
| InChI | InChI=1S/C15H9N2O.C5H2F6O2.Ir/c1-2-8-14-11(5-1)12-6-3-7-13(15(12)18-14)17-10-4-9-16-17;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-6,8-10H;1,12H;/q-1;;/b;2-1-; |
| InChIKey | VWGGZWRZADRRBU-FJOGWHKWSA-N |
| XLogP | 5.69 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|