C20H22IrNO- — CID 140735894
1-(3H-dibenzofuran-3-id-4-yl)-2,2,4,4-tetramethylpyrrolidine;iridium (PubChem CID 140735894) has the molecular formula C20H22IrNO- and a molecular weight of 484.62 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-4-yl)-2,2,4,4-tetramethylpyrrolidine;iridium.
| Compound Name | 1-(3H-dibenzofuran-3-id-4-yl)-2,2,4,4-tetramethylpyrrolidine;iridium |
|---|---|
| PubChem CID | 140735894 |
| Molecular Formula | C20H22IrNO- |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-4-yl)-2,2,4,4-tetramethylpyrrolidine;iridium |
| SMILES | CC1(C)CN(c2[c-]ccc3c2oc2ccccc23)C(C)(C)C1.[Ir] |
| InChI | InChI=1S/C20H22NO.Ir/c1-19(2)12-20(3,4)21(13-19)16-10-7-9-15-14-8-5-6-11-17(14)22-18(15)16;/h5-9,11H,12-13H2,1-4H3;/q-1; |
| InChIKey | LKBSEBMQFGWZEK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|