C23H14IrNO- — CID 171576776
2-(3H-dibenzofuran-3-id-4-yl)-4-phenylpyridine;iridium (PubChem CID 171576776) has the molecular formula C23H14IrNO- and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-4-phenylpyridine;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-4-phenylpyridine;iridium |
|---|---|
| PubChem CID | 171576776 |
| Molecular Formula | C23H14IrNO- |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-4-phenylpyridine;iridium |
| SMILES | [Ir].[c-]1ccc2c(oc3ccccc32)c1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C23H14NO.Ir/c1-2-7-16(8-3-1)17-13-14-24-21(15-17)20-11-6-10-19-18-9-4-5-12-22(18)25-23(19)20;/h1-10,12-15H;/q-1; |
| InChIKey | WXRHXUNHQKLZBF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|