C39H30IrN2O2-2 — CID 171590578
4-tert-butyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;iridium;4-pyridin-2-yl-3H-xanthen-3-id-9-one (PubChem CID 171590578) has the molecular formula C39H30IrN2O2-2 and a molecular weight of 750.90 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;iridium;4-pyridin-2-yl-3H-xanthen-3-id-9-one.
| Compound Name | 4-tert-butyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;iridium;4-pyridin-2-yl-3H-xanthen-3-id-9-one |
|---|---|
| PubChem CID | 171590578 |
| Molecular Formula | C39H30IrN2O2-2 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 751.19 |
| IUPAC Name | 4-tert-butyl-2-(3-phenylbenzene-6-id-1-yl)pyridine;iridium;4-pyridin-2-yl-3H-xanthen-3-id-9-one |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]ccc(-c3ccccc3)c2)c1.O=c1c2ccccc2oc2c(-c3ccccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C21H20N.C18H10NO2.Ir/c1-21(2,3)19-12-13-22-20(15-19)18-11-7-10-17(14-18)16-8-5-4-6-9-16;20-17-13-6-1-2-10-16(13)21-18-12(7-5-8-14(17)18)15-9-3-4-11-19-15;/h4-10,12-15H,1-3H3;1-6,8-11H;/q2*-1; |
| InChIKey | KNXNPYVFTSVGEJ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|