About 2-pyrazol-1-yl-3,1-benzoxazin-4-one
2-pyrazol-1-yl-3,1-benzoxazin-4-one (PubChem CID 134853817) has the molecular formula C11H7N3O2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-pyrazol-1-yl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-pyrazol-1-yl-3,1-benzoxazin-4-one |
| PubChem CID | 134853817 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-pyrazol-1-yl-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-n2cccn2)nc2ccccc12 |
| InChI | InChI=1S/C11H7N3O2/c15-10-8-4-1-2-5-9(8)13-11(16-10)14-7-3-6-12-14/h1-7H |
| InChIKey | POFGPJGCGQFWOZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrazol-1-yl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-yl-3,1-benzoxazin-4-one?
The IUPAC name of 2-pyrazol-1-yl-3,1-benzoxazin-4-one (CID 134853817) is 2-pyrazol-1-yl-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-pyrazol-1-yl-3,1-benzoxazin-4-one?
The canonical SMILES for 2-pyrazol-1-yl-3,1-benzoxazin-4-one is O=c1oc(-n2cccn2)nc2ccccc12.
What is the InChIKey of 2-pyrazol-1-yl-3,1-benzoxazin-4-one?
The InChIKey is POFGPJGCGQFWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2/c15-10-8-4-1-2-5-9(8)13-11(16-10)14-7-3-6-12-14/h1-7H.
What are the key properties of 2-pyrazol-1-yl-3,1-benzoxazin-4-one?
2-pyrazol-1-yl-3,1-benzoxazin-4-one has a molecular weight of 213.20 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-yl-3,1-benzoxazin-4-one is sourced from PubChem (CID 134853817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).