C19H26IrN2-2 — CID 140677085
1,4,4,5,5,6,6-heptamethyl-3-phenyl-2H-cyclopenta[d]imidazol-2-ide;iridium (PubChem CID 140677085) has the molecular formula C19H26IrN2-2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 1,4,4,5,5,6,6-heptamethyl-3-phenyl-2H-cyclopenta[d]imidazol-2-ide;iridium.
| Compound Name | 1,4,4,5,5,6,6-heptamethyl-3-phenyl-2H-cyclopenta[d]imidazol-2-ide;iridium |
|---|---|
| PubChem CID | 140677085 |
| Molecular Formula | C19H26IrN2-2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1,4,4,5,5,6,6-heptamethyl-3-phenyl-2H-cyclopenta[d]imidazol-2-ide;iridium |
| SMILES | CN1[CH-]N(c2[c-]cccc2)C2=C1C(C)(C)C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C19H26N2.Ir/c1-17(2)15-16(18(3,4)19(17,5)6)21(13-20(15)7)14-11-9-8-10-12-14;/h8-11,13H,1-7H3;/q-2; |
| InChIKey | SQAQPAYMUJLLPX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|