C60H40IrN4O2-2 — CID 154588879
(Z)-1-[2-[3,5-bis[2-(12H-imidazo[1,2-f]phenanthridin-12-id-10-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium (PubChem CID 154588879) has the molecular formula C60H40IrN4O2-2 and a molecular weight of 1041.22 g/mol. Its IUPAC name is (Z)-1-[2-[3,5-bis[2-(12H-imidazo[1,2-f]phenanthridin-12-id-10-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium.
| Compound Name | (Z)-1-[2-[3,5-bis[2-(12H-imidazo[1,2-f]phenanthridin-12-id-10-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154588879 |
| Molecular Formula | C60H40IrN4O2-2 |
| Molecular Weight | 1041.22 g/mol |
| Exact Mass | 1041.28 |
| IUPAC Name | (Z)-1-[2-[3,5-bis[2-(12H-imidazo[1,2-f]phenanthridin-12-id-10-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
| SMILES | C/C(O)=C\C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2c[c-]c3c(c2)c2ccccc2n2ccnc32)cc(-c2ccccc2-c2c[c-]c3c(c2)c2ccccc2n2ccnc32)c1.[Ir] |
| InChI | InChI=1S/C60H40N4O2.Ir/c1-38(65)32-45(66)25-22-39-12-2-3-13-46(39)42-33-43(49-16-6-4-14-47(49)40-23-26-53-55(36-40)51-18-8-10-20-57(51)63-30-28-61-59(53)63)35-44(34-42)50-17-7-5-15-48(50)41-24-27-54-56(37-41)52-19-9-11-21-58(52)64-31-29-62-60(54)64;/h2-21,23-24,28-37,65H,22,25H2,1H3;/q-2;/b38-32+; |
| InChIKey | QGTWUNWRWOCGMX-VDLOZBHZSA-N |
| XLogP | 14.49 |
| TPSA | 71.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.22 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|