C30H29IrN2O2- — CID 59358822
(Z)-4-hydroxypent-3-en-2-one;iridium;5-methyl-9-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 59358822) has the molecular formula C30H29IrN2O2- and a molecular weight of 641.79 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;5-methyl-9-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;5-methyl-9-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 59358822 |
| Molecular Formula | C30H29IrN2O2- |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;5-methyl-9-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C)c(-c2cc[c-]c3c2c2cccc(C)c2n2ccnc32)c(C)c1.[Ir] |
| InChI | InChI=1S/C25H21N2.C5H8O2.Ir/c1-15-13-17(3)22(18(4)14-15)19-8-6-10-21-23(19)20-9-5-7-16(2)24(20)27-12-11-26-25(21)27;1-4(6)3-5(2)7;/h5-9,11-14H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | UDQDKAWZQOSVAM-LWFKIUJUSA-N |
| XLogP | 7.38 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|