C27H30IrNO4- — CID 59661644
(Z)-4-hydroxypent-3-en-2-one;iridium;4-methoxy-2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine (PubChem CID 59661644) has the molecular formula C27H30IrNO4- and a molecular weight of 624.76 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-methoxy-2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methoxy-2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 59661644 |
| Molecular Formula | C27H30IrNO4- |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methoxy-2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]pyridine |
| SMILES | CC(=O)/C=C(/C)O.COc1ccnc(-c2[c-]cc(OC)cc2-c2c(C)cc(C)cc2C)c1.[Ir] |
| InChI | InChI=1S/C22H22NO2.C5H8O2.Ir/c1-14-10-15(2)22(16(3)11-14)20-12-17(24-4)6-7-19(20)21-13-18(25-5)8-9-23-21;1-4(6)3-5(2)7;/h6,8-13H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RDOWCCPBFSXBLR-LWFKIUJUSA-N |
| XLogP | 6.19 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|