C28H33N2O3Pt- — CID 58401626
(Z)-4-hydroxypent-3-en-2-one;1-[2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum (PubChem CID 58401626) has the molecular formula C28H33N2O3Pt- and a molecular weight of 640.66 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;1-[2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;1-[2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum |
|---|---|
| PubChem CID | 58401626 |
| Molecular Formula | C28H33N2O3Pt- |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;1-[2-[4-methoxy-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum |
| SMILES | CC(=O)/C=C(/C)O.CNCc1ccnc(-c2[c-]cc(OC)cc2-c2c(C)cc(C)cc2C)c1.[Pt] |
| InChI | InChI=1S/C23H25N2O.C5H8O2.Pt/c1-15-10-16(2)23(17(3)11-15)21-13-19(26-5)6-7-20(21)22-12-18(14-24-4)8-9-25-22;1-4(6)3-5(2)7;/h6,8-13,24H,14H2,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | LERHYVFNVRPIEE-LWFKIUJUSA-N |
| XLogP | 5.90 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|