C25H34NO5Pt- — CID 58401881
[2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum (PubChem CID 58401881) has the molecular formula C25H34NO5Pt- and a molecular weight of 623.63 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum.
| Compound Name | [2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum |
|---|---|
| PubChem CID | 58401881 |
| Molecular Formula | C25H34NO5Pt- |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;platinum |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.COc1c[c-]c(-c2cc(CO)ccn2)c(CO)c1.[Pt] |
| InChI | InChI=1S/C14H14NO3.C11H20O2.Pt/c1-18-12-2-3-13(11(7-12)9-17)14-6-10(8-16)4-5-15-14;1-10(2,3)8(12)7-9(13)11(4,5)6;/h2,4-7,16-17H,8-9H2,1H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | VVCPCTRCLSFGJY-HXIBTQJOSA-N |
| XLogP | 4.63 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|