C29H26N3O4Pt- — CID 58401452
[2-[2-(hydroxymethyl)-4-pyrido[3,2-b]indol-5-ylbenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401452) has the molecular formula C29H26N3O4Pt- and a molecular weight of 675.62 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4-pyrido[3,2-b]indol-5-ylbenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | [2-[2-(hydroxymethyl)-4-pyrido[3,2-b]indol-5-ylbenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401452 |
| Molecular Formula | C29H26N3O4Pt- |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4-pyrido[3,2-b]indol-5-ylbenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.OCc1ccnc(-c2[c-]cc(-n3c4ccccc4c4ncccc43)cc2CO)c1.[Pt] |
| InChI | InChI=1S/C24H18N3O2.C5H8O2.Pt/c28-14-16-9-11-25-21(12-16)19-8-7-18(13-17(19)15-29)27-22-5-2-1-4-20(22)24-23(27)6-3-10-26-24;1-4(6)3-5(2)7;/h1-7,9-13,28-29H,14-15H2;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WXRCTYQSENMXEU-LWFKIUJUSA-N |
| XLogP | 5.06 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|