C24H24NO4PtS- — CID 58401559
(Z)-4-hydroxypent-3-en-2-one;[5-methoxy-2-(4-phenylsulfanyl-2-pyridinyl)benzene-3-id-1-yl]methanol;platinum (PubChem CID 58401559) has the molecular formula C24H24NO4PtS- and a molecular weight of 617.60 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;[5-methoxy-2-(4-phenylsulfanyl-2-pyridinyl)benzene-3-id-1-yl]methanol;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;[5-methoxy-2-(4-phenylsulfanyl-2-pyridinyl)benzene-3-id-1-yl]methanol;platinum |
|---|---|
| PubChem CID | 58401559 |
| Molecular Formula | C24H24NO4PtS- |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;[5-methoxy-2-(4-phenylsulfanyl-2-pyridinyl)benzene-3-id-1-yl]methanol;platinum |
| SMILES | CC(=O)/C=C(/C)O.COc1c[c-]c(-c2cc(Sc3ccccc3)ccn2)c(CO)c1.[Pt] |
| InChI | InChI=1S/C19H16NO2S.C5H8O2.Pt/c1-22-15-7-8-18(14(11-15)13-21)19-12-17(9-10-20-19)23-16-5-3-2-4-6-16;1-4(6)3-5(2)7;/h2-7,9-12,21H,13H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | BBFUCVOFAHPQQR-LWFKIUJUSA-N |
| XLogP | 5.24 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|