C19H20F2NO3Pt- — CID 58401271
2-(2,4-difluorobenzene-6-id-1-yl)-4-propan-2-yloxypyridine;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401271) has the molecular formula C19H20F2NO3Pt- and a molecular weight of 543.45 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-4-propan-2-yloxypyridine;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-propan-2-yloxypyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401271 |
| Molecular Formula | C19H20F2NO3Pt- |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-propan-2-yloxypyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.CC(C)Oc1ccnc(-c2[c-]cc(F)cc2F)c1.[Pt] |
| InChI | InChI=1S/C14H12F2NO.C5H8O2.Pt/c1-9(2)18-11-5-6-17-14(8-11)12-4-3-10(15)7-13(12)16;1-4(6)3-5(2)7;/h3,5-9H,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | QGNUVDVJHCNRRX-LWFKIUJUSA-N |
| XLogP | 4.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|