C14H13F2IrNO2 — CID 58986552
2-(2,4-difluorobenzene-6-id-1-yl)-4-methylpyridine;1-hydroxyethylideneoxidanium;iridium (PubChem CID 58986552) has the molecular formula C14H13F2IrNO2 and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-4-methylpyridine;1-hydroxyethylideneoxidanium;iridium.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-methylpyridine;1-hydroxyethylideneoxidanium;iridium |
|---|---|
| PubChem CID | 58986552 |
| Molecular Formula | C14H13F2IrNO2 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-methylpyridine;1-hydroxyethylideneoxidanium;iridium |
| SMILES | Cc1ccnc(-c2[c-]cc(F)cc2F)c1.[H]/[O+]=C(\C)O.[Ir] |
| InChI | InChI=1S/C12H8F2N.C2H4O2.Ir/c1-8-4-5-15-12(6-8)10-3-2-9(13)7-11(10)14;1-2(3)4;/h2,4-7H,1H3;1H3,(H,3,4);/q-1;;/p+1 |
| InChIKey | KWFNCLQPMXNZMP-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|