C18H17F4IrNO2 — CID 58881251
2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58881251) has the molecular formula C18H17F4IrNO2 and a molecular weight of 547.55 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 58881251 |
| Molecular Formula | C18H17F4IrNO2 |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | Cc1ccnc(-c2[c-]cc(F)c(C(F)(F)F)c2)c1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C13H8F4N.C5H8O2.Ir/c1-8-4-5-18-12(6-8)9-2-3-11(14)10(7-9)13(15,16)17;1-4(6)3-5(2)7;/h3-7H,1H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | XWRBEAFFRWFSKR-LWFKIUJUSA-O |
| XLogP | 5.03 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|