C28H29IrNO3 — CID 162470282
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;4-(4-methoxybenzene-6-id-1-yl)-7,8,9-trimethylbenzo[f]isoquinoline (PubChem CID 162470282) has the molecular formula C28H29IrNO3 and a molecular weight of 619.76 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;4-(4-methoxybenzene-6-id-1-yl)-7,8,9-trimethylbenzo[f]isoquinoline.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;4-(4-methoxybenzene-6-id-1-yl)-7,8,9-trimethylbenzo[f]isoquinoline |
|---|---|
| PubChem CID | 162470282 |
| Molecular Formula | C28H29IrNO3 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;4-(4-methoxybenzene-6-id-1-yl)-7,8,9-trimethylbenzo[f]isoquinoline |
| SMILES | COc1c[c-]c(-c2nccc3c2ccc2c(C)c(C)c(C)cc23)cc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C23H20NO.C5H8O2.Ir/c1-14-13-22-19(16(3)15(14)2)9-10-21-20(22)11-12-24-23(21)17-5-7-18(25-4)8-6-17;1-4(6)3-5(2)7;/h5,7-13H,1-4H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | PEKIDRAQANRSIF-LWFKIUJUSA-O |
| XLogP | 6.80 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|