C37H41IrNO2 — CID 169291525
[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium;1-(3,4,5-trimethylbenzene-6-id-1-yl)naphtho[2,1-f]isoquinoline (PubChem CID 169291525) has the molecular formula C37H41IrNO2 and a molecular weight of 723.96 g/mol. Its IUPAC name is [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium;1-(3,4,5-trimethylbenzene-6-id-1-yl)naphtho[2,1-f]isoquinoline.
| Compound Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium;1-(3,4,5-trimethylbenzene-6-id-1-yl)naphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 169291525 |
| Molecular Formula | C37H41IrNO2 |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium;1-(3,4,5-trimethylbenzene-6-id-1-yl)naphtho[2,1-f]isoquinoline |
| SMILES | Cc1[c-]c(-c2nccc3c2ccc2c4ccccc4ccc32)cc(C)c1C.[H]/[O+]=C(/C=C(\O)C(C)(C)C)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C26H20N.C11H20O2.Ir/c1-16-14-20(15-17(2)18(16)3)26-25-11-10-22-21-7-5-4-6-19(21)8-9-23(22)24(25)12-13-27-26;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-14H,1-3H3;7,12H,1-6H3;/q-1;;/p+1/b;8-7-; |
| InChIKey | KSUYYERSIJPISM-HXIBTQJOSA-O |
| XLogP | 10.00 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|