C40H45IrNO2 — CID 162470318
4-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]benzo[f]isoquinoline;[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium (PubChem CID 162470318) has the molecular formula C40H45IrNO2 and a molecular weight of 764.02 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]benzo[f]isoquinoline;[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium.
| Compound Name | 4-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]benzo[f]isoquinoline;[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 162470318 |
| Molecular Formula | C40H45IrNO2 |
| Molecular Weight | 764.02 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | 4-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]benzo[f]isoquinoline;[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;iridium |
| SMILES | CC(C)(C)c1ccc(-c2cc[c-]c(-c3nccc4c3ccc3ccccc34)c2)cc1.[H]/[O+]=C(/C=C(\O)C(C)(C)C)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C29H24N.C11H20O2.Ir/c1-29(2,3)24-14-11-20(12-15-24)22-8-6-9-23(19-22)28-27-16-13-21-7-4-5-10-25(21)26(27)17-18-30-28;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-8,10-19H,1-3H3;7,12H,1-6H3;/q-1;;/p+1/b;8-7-; |
| InChIKey | WHGAXEOQTMGIAL-HXIBTQJOSA-O |
| XLogP | 10.88 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.02 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|