C28H28FIrNO2 — CID 162480513
4-(3-fluorobenzene-6-id-1-yl)benzo[f]isoquinoline;[(Z)-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium (PubChem CID 162480513) has the molecular formula C28H28FIrNO2 and a molecular weight of 621.75 g/mol. Its IUPAC name is 4-(3-fluorobenzene-6-id-1-yl)benzo[f]isoquinoline;[(Z)-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium.
| Compound Name | 4-(3-fluorobenzene-6-id-1-yl)benzo[f]isoquinoline;[(Z)-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 162480513 |
| Molecular Formula | C28H28FIrNO2 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 4-(3-fluorobenzene-6-id-1-yl)benzo[f]isoquinoline;[(Z)-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium |
| SMILES | Fc1cc[c-]c(-c2nccc3c2ccc2ccccc23)c1.[H]/[O+]=C(/C=C(\O)CCC)CCC.[Ir] |
| InChI | InChI=1S/C19H11FN.C9H16O2.Ir/c20-15-6-3-5-14(12-15)19-18-9-8-13-4-1-2-7-16(13)17(18)10-11-21-19;1-3-5-8(10)7-9(11)6-4-2;/h1-4,6-12H;7,10H,3-6H2,1-2H3;/q-1;;/p+1/b;8-7-; |
| InChIKey | HPSSGHWZPAOGFJ-HXIBTQJOSA-O |
| XLogP | 7.57 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|