C26H25IrN2O2- — CID 168852607
(Z)-4-hydroxypent-3-en-2-one;iridium;4-(3,4,5-trimethylbenzene-6-id-1-yl)-3,8-phenanthroline (PubChem CID 168852607) has the molecular formula C26H25IrN2O2- and a molecular weight of 589.72 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-(3,4,5-trimethylbenzene-6-id-1-yl)-3,8-phenanthroline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-(3,4,5-trimethylbenzene-6-id-1-yl)-3,8-phenanthroline |
|---|---|
| PubChem CID | 168852607 |
| Molecular Formula | C26H25IrN2O2- |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-(3,4,5-trimethylbenzene-6-id-1-yl)-3,8-phenanthroline |
| SMILES | CC(=O)/C=C(/C)O.Cc1[c-]c(-c2nccc3c2ccc2cnccc23)cc(C)c1C.[Ir] |
| InChI | InChI=1S/C21H17N2.C5H8O2.Ir/c1-13-10-17(11-14(2)15(13)3)21-20-5-4-16-12-22-8-6-18(16)19(20)7-9-23-21;1-4(6)3-5(2)7;/h4-10,12H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | UOFFEZWAIRNKEW-LWFKIUJUSA-N |
| XLogP | 6.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|