C13H10F2IrN- — CID 59404034
2-(2,4-difluorobenzene-6-id-1-yl)-4,5-dimethylpyridine;iridium (PubChem CID 59404034) has the molecular formula C13H10F2IrN- and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-4,5-dimethylpyridine;iridium.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4,5-dimethylpyridine;iridium |
|---|---|
| PubChem CID | 59404034 |
| Molecular Formula | C13H10F2IrN- |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4,5-dimethylpyridine;iridium |
| SMILES | Cc1cnc(-c2[c-]cc(F)cc2F)cc1C.[Ir] |
| InChI | InChI=1S/C13H10F2N.Ir/c1-8-5-13(16-7-9(8)2)11-4-3-10(14)6-12(11)15;/h3,5-7H,1-2H3;/q-1; |
| InChIKey | YOGDSMXWSJFSPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|