C29H24IrN2O2S-2 — CID 58401898
iridium;[5-methoxy-2-[4-(sulfanylmethyl)-2-pyridinyl]benzene-3-id-1-yl]methanol;1-phenylisoquinoline (PubChem CID 58401898) has the molecular formula C29H24IrN2O2S-2 and a molecular weight of 656.81 g/mol. Its IUPAC name is iridium;[5-methoxy-2-[4-(sulfanylmethyl)-2-pyridinyl]benzene-3-id-1-yl]methanol;1-phenylisoquinoline.
| Compound Name | iridium;[5-methoxy-2-[4-(sulfanylmethyl)-2-pyridinyl]benzene-3-id-1-yl]methanol;1-phenylisoquinoline |
|---|---|
| PubChem CID | 58401898 |
| Molecular Formula | C29H24IrN2O2S-2 |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | iridium;[5-methoxy-2-[4-(sulfanylmethyl)-2-pyridinyl]benzene-3-id-1-yl]methanol;1-phenylisoquinoline |
| SMILES | COc1c[c-]c(-c2cc(CS)ccn2)c(CO)c1.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.C14H14NO2S.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;1-17-12-2-3-13(11(7-12)8-16)14-6-10(9-18)4-5-15-14;/h1-7,9-11H;2,4-7,16,18H,8-9H2,1H3;/q2*-1; |
| InChIKey | VFCGIDFHLIJCDQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|