C36H22IrN2-2 — CID 59621766
iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;1-phenylisoquinoline (PubChem CID 59621766) has the molecular formula C36H22IrN2-2 and a molecular weight of 674.80 g/mol. Its IUPAC name is iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;1-phenylisoquinoline.
| Compound Name | iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;1-phenylisoquinoline |
|---|---|
| PubChem CID | 59621766 |
| Molecular Formula | C36H22IrN2-2 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 675.14 |
| IUPAC Name | iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;1-phenylisoquinoline |
| SMILES | [Ir].[c-]1ccccc1-c1cc2c3c(cccc3n1)-c1ccccc1-2.[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C21H12N.C15H10N.Ir/c1-2-7-14(8-3-1)20-13-18-16-10-5-4-9-15(16)17-11-6-12-19(22-20)21(17)18;1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-7,9-13H;1-7,9-11H;/q2*-1; |
| InChIKey | QEHGOIUTYCVWKJ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|