C25H14IrN- — CID 59622068
iridium;10-phenyl-11-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene (PubChem CID 59622068) has the molecular formula C25H14IrN- and a molecular weight of 520.61 g/mol. Its IUPAC name is iridium;10-phenyl-11-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene.
| Compound Name | iridium;10-phenyl-11-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 59622068 |
| Molecular Formula | C25H14IrN- |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | iridium;10-phenyl-11-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
| SMILES | [Ir].[c-]1ccccc1-c1cc2c3c(c4ccccc4cc3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C25H14N.Ir/c1-2-8-16(9-3-1)22-15-21-19-12-6-7-13-20(19)24-18-11-5-4-10-17(18)14-23(26-22)25(21)24;/h1-8,10-15H;/q-1; |
| InChIKey | CTRHLJDROXYGRH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|