C17H10NPt- — CID 59621960
6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;platinum (PubChem CID 59621960) has the molecular formula C17H10NPt- and a molecular weight of 423.35 g/mol. Its IUPAC name is 6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;platinum.
| Compound Name | 6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;platinum |
|---|---|
| PubChem CID | 59621960 |
| Molecular Formula | C17H10NPt- |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;platinum |
| SMILES | [Pt].[c-]1ccccc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C17H10N.Pt/c1-2-5-12(6-3-1)16-11-14-10-9-13-7-4-8-15(18-16)17(13)14;/h1-5,7-11H;/q-1; |
| InChIKey | OCYRYWXWHSFELL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|