C30H20IrN2-2 — CID 59621429
6,10-dihydro-5H-benzo[h]quinolin-10-ide;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59621429) has the molecular formula C30H20IrN2-2 and a molecular weight of 600.72 g/mol. Its IUPAC name is 6,10-dihydro-5H-benzo[h]quinolin-10-ide;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 6,10-dihydro-5H-benzo[h]quinolin-10-ide;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59621429 |
| Molecular Formula | C30H20IrN2-2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 6,10-dihydro-5H-benzo[h]quinolin-10-ide;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | [Ir].[c-]1cccc2c1-c1ncccc1CC2.[c-]1ccccc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C17H10N.C13H10N.Ir/c1-2-5-12(6-3-1)16-11-14-10-9-13-7-4-8-15(18-16)17(13)14;1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;/h1-5,7-11H;1-5,9H,7-8H2;/q2*-1; |
| InChIKey | NBIVJCAEEMRWGQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|