C45H54IrN3- — CID 59622146
iridium;4-nonyl-2-(4-nonyl-2-pyridinyl)pyridine;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59622146) has the molecular formula C45H54IrN3- and a molecular weight of 829.16 g/mol. Its IUPAC name is iridium;4-nonyl-2-(4-nonyl-2-pyridinyl)pyridine;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | iridium;4-nonyl-2-(4-nonyl-2-pyridinyl)pyridine;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59622146 |
| Molecular Formula | C45H54IrN3- |
| Molecular Weight | 829.16 g/mol |
| Exact Mass | 829.40 |
| IUPAC Name | iridium;4-nonyl-2-(4-nonyl-2-pyridinyl)pyridine;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | CCCCCCCCCc1ccnc(-c2cc(CCCCCCCCC)ccn2)c1.[Ir].[c-]1ccccc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C28H44N2.C17H10N.Ir/c1-3-5-7-9-11-13-15-17-25-19-21-29-27(23-25)28-24-26(20-22-30-28)18-16-14-12-10-8-6-4-2;1-2-5-12(6-3-1)16-11-14-10-9-13-7-4-8-15(18-16)17(13)14;/h19-24H,3-18H2,1-2H3;1-5,7-11H;/q;-1; |
| InChIKey | IFXIPKFDSYCMPL-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.16 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|