About CID 59621830
CID 59621830 (PubChem CID 59621830) has the molecular formula C49H55IrN3-2
and a molecular weight of 878.22 g/mol.
Molecular Properties
| Compound Name | CID 59621830 |
| PubChem CID | 59621830 |
| Molecular Formula | C49H55IrN3-2 |
| Molecular Weight | 878.22 g/mol |
| Exact Mass | 878.40 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCc1ccnc(-c2cc(CCCCCCCCC)ccn2)c1.[Ir].[c-]1ccccc1-c1cc2c3c(cc[c-]c3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C28H44N2.C21H11N.Ir/c1-3-5-7-9-11-13-15-17-25-19-21-29-27(23-25)28-24-26(20-22-30-28)18-16-14-12-10-8-6-4-2;1-2-7-14(8-3-1)20-13-18-16-10-5-4-9-15(16)17-11-6-12-19(22-20)21(17)18;/h19-24H,3-18H2,1-2H3;1-7,9-11,13H;/q;-2; |
| InChIKey | LDHODALUVJPIOX-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 878.22 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59621830 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59621830?
The IUPAC name of CID 59621830 (CID 59621830) is not available.
What is the SMILES notation for CID 59621830?
The canonical SMILES for CID 59621830 is CCCCCCCCCc1ccnc(-c2cc(CCCCCCCCC)ccn2)c1.[Ir].[c-]1ccccc1-c1cc2c3c(cc[c-]c3n1)-c1ccccc1-2.
What is the InChIKey of CID 59621830?
The InChIKey is LDHODALUVJPIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44N2.C21H11N.Ir/c1-3-5-7-9-11-13-15-17-25-19-21-29-27(23-25)28-24-26(20-22-30-28)18-16-14-12-10-8-6-4-2;1-2-7-14(8-3-1)20-13-18-16-10-5-4-9-15(16)17-11-6-12-19(22-20)21(17)18;/h19-24H,3-18H2,1-2H3;1-7,9-11,13H;/q;-2;.
What are the key properties of CID 59621830?
CID 59621830 has a molecular weight of 878.22 g/mol, XLogP of 13.88, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59621830 is sourced from PubChem (CID 59621830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).