C33H18ClIrN3-2 — CID 59622029
CID 59622029 (PubChem CID 59622029) has the molecular formula C33H18ClIrN3-2 and a molecular weight of 684.20 g/mol.
| Compound Name | CID 59622029 |
|---|---|
| PubChem CID | 59622029 |
| Molecular Formula | C33H18ClIrN3-2 |
| Molecular Weight | 684.20 g/mol |
| Exact Mass | 684.08 |
| IUPAC Name | — |
| SMILES | Clc1cc2cccnc2c2ncccc12.[Ir].[c-]1ccccc1-c1cc2c3c(cc[c-]c3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C21H11N.C12H7ClN2.Ir/c1-2-7-14(8-3-1)20-13-18-16-10-5-4-9-15(16)17-11-6-12-19(22-20)21(17)18;13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12;/h1-7,9-11,13H;1-7H;/q-2;; |
| InChIKey | ALHNHTIDLIJDLI-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.20 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|