C30H20IrN3- — CID 59621550
iridium;5-methyl-1,10-phenanthroline;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59621550) has the molecular formula C30H20IrN3- and a molecular weight of 614.73 g/mol. Its IUPAC name is iridium;5-methyl-1,10-phenanthroline;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | iridium;5-methyl-1,10-phenanthroline;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59621550 |
| Molecular Formula | C30H20IrN3- |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | iridium;5-methyl-1,10-phenanthroline;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | Cc1cc2cccnc2c2ncccc12.[Ir].[c-]1ccccc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C17H10N.C13H10N2.Ir/c1-2-5-12(6-3-1)16-11-14-10-9-13-7-4-8-15(18-16)17(13)14;1-9-8-10-4-2-6-14-12(10)13-11(9)5-3-7-15-13;/h1-5,7-11H;2-8H,1H3;/q-1;; |
| InChIKey | WWZXQQUARCJEEK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|