C26H20IrN- — CID 59621941
iridium;6-[3-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59621941) has the molecular formula C26H20IrN- and a molecular weight of 538.67 g/mol. Its IUPAC name is iridium;6-[3-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | iridium;6-[3-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59621941 |
| Molecular Formula | C26H20IrN- |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | iridium;6-[3-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | Cc1cc(C)c(-c2cc[c-]c(-c3cc4c5c(cccc5n3)C=C4)c2)c(C)c1.[Ir] |
| InChI | InChI=1S/C26H20N.Ir/c1-16-12-17(2)25(18(3)13-16)21-8-4-7-20(14-21)24-15-22-11-10-19-6-5-9-23(27-24)26(19)22;/h4-6,8-15H,1-3H3;/q-1; |
| InChIKey | NLDNVJMULXFGCM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|