C35H22IrN- — CID 59621695
6-[3-(3,5-diphenylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium (PubChem CID 59621695) has the molecular formula C35H22IrN- and a molecular weight of 648.79 g/mol. Its IUPAC name is 6-[3-(3,5-diphenylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium.
| Compound Name | 6-[3-(3,5-diphenylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium |
|---|---|
| PubChem CID | 59621695 |
| Molecular Formula | C35H22IrN- |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 649.14 |
| IUPAC Name | 6-[3-(3,5-diphenylphenyl)benzene-6-id-1-yl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium |
| SMILES | [Ir].[c-]1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C35H22N.Ir/c1-3-9-24(10-4-1)30-20-31(25-11-5-2-6-12-25)22-32(21-30)27-14-7-15-28(19-27)34-23-29-18-17-26-13-8-16-33(36-34)35(26)29;/h1-14,16-23H;/q-1; |
| InChIKey | KLCVEUCPCHSIOQ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|