C28H22IrNO2- — CID 149363015
4-hydroxypent-3-en-2-one;iridium;6-(3-phenylbenzene-6-id-1-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 149363015) has the molecular formula C28H22IrNO2- and a molecular weight of 596.71 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;iridium;6-(3-phenylbenzene-6-id-1-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 4-hydroxypent-3-en-2-one;iridium;6-(3-phenylbenzene-6-id-1-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 149363015 |
| Molecular Formula | C28H22IrNO2- |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;iridium;6-(3-phenylbenzene-6-id-1-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C23H14N.C5H8O2.Ir/c1-2-6-16(7-3-1)18-9-4-10-19(14-18)22-15-20-13-12-17-8-5-11-21(24-22)23(17)20;1-4(6)3-5(2)7;/h1-9,11-15H;3,6H,1-2H3;/q-1;; |
| InChIKey | NTRYAGSSNLLTGR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|