C20H16IrNO3- — CID 147057861
6-(3H-furan-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;4-hydroxypent-3-en-2-one;iridium (PubChem CID 147057861) has the molecular formula C20H16IrNO3- and a molecular weight of 510.57 g/mol. Its IUPAC name is 6-(3H-furan-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 6-(3H-furan-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 147057861 |
| Molecular Formula | C20H16IrNO3- |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 6-(3H-furan-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1ccoc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C15H8NO.C5H8O2.Ir/c1-3-10-6-7-11-9-13(14-5-2-8-17-14)16-12(4-1)15(10)11;1-4(6)3-5(2)7;/h1-4,6-9H;3,6H,1-2H3;/q-1;; |
| InChIKey | XQHWKZDXHFPTPF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|